C20H24N4O2S — CID 134007567
4-benzyl-2-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione (PubChem CID 134007567) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-benzyl-2-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 134007567 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-benzyl-2-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
| SMILES | CC1CN(Cn2nc(-c3ccco3)n(Cc3ccccc3)c2=S)C(C)CO1 |
| InChI | InChI=1S/C20H24N4O2S/c1-15-13-26-16(2)11-22(15)14-24-20(27)23(12-17-7-4-3-5-8-17)19(21-24)18-9-6-10-25-18/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | XKFROWOOIYAOKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|