C22H24N6O4S — CID 46567148
5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 46567148) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 46567148 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(C2COc3ccccc3O2)nn(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c1=S |
| InChI | InChI=1S/C22H24N6O4S/c1-24-21(20-14-31-18-4-2-3-5-19(18)32-20)23-27(22(24)33)15-25-10-12-26(13-11-25)16-6-8-17(9-7-16)28(29)30/h2-9,20H,10-15H2,1H3 |
| InChIKey | MYBJZVZZFSRLBH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|