C18H22N6O3S2 — CID 25333403
N-cyclopropyl-N-[4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 25333403) has the molecular formula C18H22N6O3S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-cyclopropyl-N-[4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 25333403 |
| Molecular Formula | C18H22N6O3S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-cyclopropyl-N-[4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nn(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c(=S)s1)C1CC1 |
| InChI | InChI=1S/C18H22N6O3S2/c1-13(25)23(15-4-5-15)17-19-22(18(28)29-17)12-20-8-10-21(11-9-20)14-2-6-16(7-3-14)24(26)27/h2-3,6-7,15H,4-5,8-12H2,1H3 |
| InChIKey | MQJHIFMTXFUBGU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|