C18H21F2N5O4 — CID 56538923
ethyl 5-(difluoromethyl)-1-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]pyrazole-4-carboxylate (PubChem CID 56538923) has the molecular formula C18H21F2N5O4 and a molecular weight of 409.39 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-1-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 56538923 |
| Molecular Formula | C18H21F2N5O4 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl 5-(difluoromethyl)-1-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c1C(F)F |
| InChI | InChI=1S/C18H21F2N5O4/c1-2-29-18(26)15-11-21-24(16(15)17(19)20)12-22-7-9-23(10-8-22)13-3-5-14(6-4-13)25(27)28/h3-6,11,17H,2,7-10,12H2,1H3 |
| InChIKey | POJYLIMBTXONBX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|