C19H24N6O5 — CID 56541279
ethyl 1-methyl-5-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]pyrazole-4-carboxylate (PubChem CID 56541279) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is ethyl 1-methyl-5-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 56541279 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | ethyl 1-methyl-5-[[2-[4-(4-nitrophenyl)piperazin-1-yl]acetyl]amino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H24N6O5/c1-3-30-19(27)16-12-20-22(2)18(16)21-17(26)13-23-8-10-24(11-9-23)14-4-6-15(7-5-14)25(28)29/h4-7,12H,3,8-11,13H2,1-2H3,(H,21,26) |
| InChIKey | XZCMGIGPKOZJIL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|