C15H16F2N2O2 — CID 63234944
ethyl 5-(difluoromethyl)-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate (PubChem CID 63234944) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 63234944 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | ethyl 5-(difluoromethyl)-1-[(4-methylphenyl)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(Cc2ccc(C)cc2)c1C(F)F |
| InChI | InChI=1S/C15H16F2N2O2/c1-3-21-15(20)12-8-18-19(13(12)14(16)17)9-11-6-4-10(2)5-7-11/h4-8,14H,3,9H2,1-2H3 |
| InChIKey | OSPYZPRERHDMDG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |