C9H12F2N2O3 — CID 63235025
ethyl 5-(difluoromethyl)-1-(2-hydroxyethyl)pyrazole-4-carboxylate (PubChem CID 63235025) has the molecular formula C9H12F2N2O3 and a molecular weight of 234.20 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1-(2-hydroxyethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-1-(2-hydroxyethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 63235025 |
| Molecular Formula | C9H12F2N2O3 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | ethyl 5-(difluoromethyl)-1-(2-hydroxyethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CCO)c1C(F)F |
| InChI | InChI=1S/C9H12F2N2O3/c1-2-16-9(15)6-5-12-13(3-4-14)7(6)8(10)11/h5,8,14H,2-4H2,1H3 |
| InChIKey | YAVCTBQFIKWEDL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |