C22H29N5S — CID 17467819
2-[[(4-tert-butylphenyl)methyl-methylamino]methyl]-4-ethyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 17467819) has the molecular formula C22H29N5S and a molecular weight of 395.58 g/mol. Its IUPAC name is 2-[[(4-tert-butylphenyl)methyl-methylamino]methyl]-4-ethyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4-tert-butylphenyl)methyl-methylamino]methyl]-4-ethyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17467819 |
| Molecular Formula | C22H29N5S |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[[(4-tert-butylphenyl)methyl-methylamino]methyl]-4-ethyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccncc2)nn(CN(C)Cc2ccc(C(C)(C)C)cc2)c1=S |
| InChI | InChI=1S/C22H29N5S/c1-6-26-20(18-11-13-23-14-12-18)24-27(21(26)28)16-25(5)15-17-7-9-19(10-8-17)22(2,3)4/h7-14H,6,15-16H2,1-5H3 |
| InChIKey | WVMUYVXXJRSJNC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|