C26H25F3N5S+ — CID 6960760
4,5-diphenyl-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 6960760) has the molecular formula C26H25F3N5S+ and a molecular weight of 496.58 g/mol. Its IUPAC name is 4,5-diphenyl-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4,5-diphenyl-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 6960760 |
| Molecular Formula | C26H25F3N5S+ |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4,5-diphenyl-2-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | FC(F)(F)c1cccc(N2CC[NH+](Cn3nc(-c4ccccc4)n(-c4ccccc4)c3=S)CC2)c1 |
| InChI | InChI=1S/C26H24F3N5S/c27-26(28,29)21-10-7-13-23(18-21)32-16-14-31(15-17-32)19-33-25(35)34(22-11-5-2-6-12-22)24(30-33)20-8-3-1-4-9-20/h1-13,18H,14-17,19H2/p+1 |
| InChIKey | ZQVFASNPGASPLG-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|