C24H24ClN6S+ — CID 2401875
2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 2401875) has the molecular formula C24H24ClN6S+ and a molecular weight of 464.02 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2401875 |
| Molecular Formula | C24H24ClN6S+ |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(C[NH+]2CCN(c3cccc(Cl)c3)CC2)nc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H23ClN6S/c25-20-7-4-10-22(16-20)29-14-12-28(13-15-29)18-30-24(32)31(21-8-2-1-3-9-21)23(27-30)19-6-5-11-26-17-19/h1-11,16-17H,12-15,18H2/p+1 |
| InChIKey | JWKIRKVYPQCOGB-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|