C21H23ClN6S — CID 27366614
2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 27366614) has the molecular formula C21H23ClN6S and a molecular weight of 426.98 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27366614 |
| Molecular Formula | C21H23ClN6S |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCN(c3cccc(Cl)c3)CC2)nc(-c2ccncc2)n1C1CC1 |
| InChI | InChI=1S/C21H23ClN6S/c22-17-2-1-3-19(14-17)26-12-10-25(11-13-26)15-27-21(29)28(18-4-5-18)20(24-27)16-6-8-23-9-7-16/h1-3,6-9,14,18H,4-5,10-13,15H2 |
| InChIKey | HERXNRACWKCELX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|