C20H23N7O2S2 — CID 55626976
4-cyclopropyl-5-pyridin-3-yl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 55626976) has the molecular formula C20H23N7O2S2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 4-cyclopropyl-5-pyridin-3-yl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-5-pyridin-3-yl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55626976 |
| Molecular Formula | C20H23N7O2S2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-cyclopropyl-5-pyridin-3-yl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | O=S(=O)(c1cccnc1)N1CCN(Cn2nc(-c3cccnc3)n(C3CC3)c2=S)CC1 |
| InChI | InChI=1S/C20H23N7O2S2/c28-31(29,18-4-2-8-22-14-18)25-11-9-24(10-12-25)15-26-20(30)27(17-5-6-17)19(23-26)16-3-1-7-21-13-16/h1-4,7-8,13-14,17H,5-6,9-12,15H2 |
| InChIKey | NRIUDBFKVSCQPC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|