C20H24N6O3S2 — CID 55626863
5-(4-methoxyphenyl)-4-methyl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 55626863) has the molecular formula C20H24N6O3S2 and a molecular weight of 460.59 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-methyl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-methoxyphenyl)-4-methyl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55626863 |
| Molecular Formula | C20H24N6O3S2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-methyl-2-[(4-pyridin-3-ylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nn(CN3CCN(S(=O)(=O)c4cccnc4)CC3)c(=S)n2C)cc1 |
| InChI | InChI=1S/C20H24N6O3S2/c1-23-19(16-5-7-17(29-2)8-6-16)22-26(20(23)30)15-24-10-12-25(13-11-24)31(27,28)18-4-3-9-21-14-18/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | GMIALIOCBQJALE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|