C19H25ClN6O2S — CID 18132992
2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione (PubChem CID 18132992) has the molecular formula C19H25ClN6O2S and a molecular weight of 436.97 g/mol. Its IUPAC name is 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18132992 |
| Molecular Formula | C19H25ClN6O2S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-4-cyclopropyl-5-propan-2-yl-1,2,4-triazole-3-thione |
| SMILES | CC(C)c1nn(CN2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)c(=S)n1C1CC1 |
| InChI | InChI=1S/C19H25ClN6O2S/c1-13(2)18-21-24(19(29)25(18)15-4-5-15)12-22-7-9-23(10-8-22)16-6-3-14(20)11-17(16)26(27)28/h3,6,11,13,15H,4-5,7-10,12H2,1-2H3 |
| InChIKey | VMAQIFYDRNTEHJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|