C20H21ClN6O2S — CID 17495317
2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 17495317) has the molecular formula C20H21ClN6O2S and a molecular weight of 444.95 g/mol. Its IUPAC name is 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17495317 |
| Molecular Formula | C20H21ClN6O2S |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(CN2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C20H21ClN6O2S/c1-15-22-25(20(30)26(15)17-5-3-2-4-6-17)14-23-9-11-24(12-10-23)18-8-7-16(21)13-19(18)27(28)29/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | FXXOQWWWKCAQAU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|