C17H25N7S — CID 18150111
4-cyclopropyl-5-propan-2-yl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 18150111) has the molecular formula C17H25N7S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-cyclopropyl-5-propan-2-yl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-5-propan-2-yl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18150111 |
| Molecular Formula | C17H25N7S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-cyclopropyl-5-propan-2-yl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CC(C)c1nn(CN2CCN(c3cnccn3)CC2)c(=S)n1C1CC1 |
| InChI | InChI=1S/C17H25N7S/c1-13(2)16-20-23(17(25)24(16)14-3-4-14)12-21-7-9-22(10-8-21)15-11-18-5-6-19-15/h5-6,11,13-14H,3-4,7-10,12H2,1-2H3 |
| InChIKey | QTJQIPUOPRJXPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|