C22H29N7S — CID 17471027
5-(4-tert-butylphenyl)-4-methyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 17471027) has the molecular formula C22H29N7S and a molecular weight of 423.59 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-methyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-tert-butylphenyl)-4-methyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17471027 |
| Molecular Formula | C22H29N7S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-methyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccc(C(C)(C)C)cc2)nn(CN2CCN(c3cnccn3)CC2)c1=S |
| InChI | InChI=1S/C22H29N7S/c1-22(2,3)18-7-5-17(6-8-18)20-25-29(21(30)26(20)4)16-27-11-13-28(14-12-27)19-15-23-9-10-24-19/h5-10,15H,11-14,16H2,1-4H3 |
| InChIKey | SNSJIVAYZGNKRU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|