C15H23N7S — CID 18167670
5-tert-butyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 18167670) has the molecular formula C15H23N7S and a molecular weight of 333.46 g/mol. Its IUPAC name is 5-tert-butyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-tert-butyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18167670 |
| Molecular Formula | C15H23N7S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 5-tert-butyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | CC(C)(C)c1nc(=S)n(CN2CCN(c3cnccn3)CC2)[nH]1 |
| InChI | InChI=1S/C15H23N7S/c1-15(2,3)13-18-14(23)22(19-13)11-20-6-8-21(9-7-20)12-10-16-4-5-17-12/h4-5,10H,6-9,11H2,1-3H3,(H,18,19,23) |
| InChIKey | DVUPYQZPBSXQEN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|