C11H18N4O — CID 63309595
2-(4-pyrazin-2-yl-1,4-diazepan-1-yl)ethanol (PubChem CID 63309595) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(4-pyrazin-2-yl-1,4-diazepan-1-yl)ethanol.
| Compound Name | 2-(4-pyrazin-2-yl-1,4-diazepan-1-yl)ethanol |
|---|---|
| PubChem CID | 63309595 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-(4-pyrazin-2-yl-1,4-diazepan-1-yl)ethanol |
| SMILES | OCCN1CCCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C11H18N4O/c16-9-8-14-4-1-5-15(7-6-14)11-10-12-2-3-13-11/h2-3,10,16H,1,4-9H2 |
| InChIKey | DICDUOKMCMJBDC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |