C12H20N6O — CID 107223282
5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide (PubChem CID 107223282) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide.
| Compound Name | 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 107223282 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(N2CCCN(CCO)CC2)cn1 |
| InChI | InChI=1S/C12H20N6O/c13-12(14)10-8-16-11(9-15-10)18-3-1-2-17(4-5-18)6-7-19/h8-9,19H,1-7H2,(H3,13,14) |
| InChIKey | VCKLTHDEKASKNY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|