About 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide
5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide (PubChem CID 107223282) has the molecular formula C12H20N6O
and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide.
Molecular Properties
| Compound Name | 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide |
| PubChem CID | 107223282 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(N2CCCN(CCO)CC2)cn1 |
| InChI | InChI=1S/C12H20N6O/c13-12(14)10-8-16-11(9-15-10)18-3-1-2-17(4-5-18)6-7-19/h8-9,19H,1-7H2,(H3,13,14) |
| InChIKey | VCKLTHDEKASKNY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide?
The IUPAC name of 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide (CID 107223282) is 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide.
What is the SMILES notation for 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide?
The canonical SMILES for 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide is [H]/N=C(\N)c1cnc(N2CCCN(CCO)CC2)cn1.
What is the InChIKey of 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide?
The InChIKey is VCKLTHDEKASKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N6O/c13-12(14)10-8-16-11(9-15-10)18-3-1-2-17(4-5-18)6-7-19/h8-9,19H,1-7H2,(H3,13,14).
What are the key properties of 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide?
5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide has a molecular weight of 264.33 g/mol, XLogP of -0.73, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyrazine-2-carboximidamide is sourced from PubChem (CID 107223282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).