C16H17FN8 — CID 17491060
2-[4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]piperazin-1-yl]pyrazine (PubChem CID 17491060) has the molecular formula C16H17FN8 and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-[4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]piperazin-1-yl]pyrazine.
| Compound Name | 2-[4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 17491060 |
| Molecular Formula | C16H17FN8 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[4-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]piperazin-1-yl]pyrazine |
| SMILES | Fc1ccc(-c2nnn(CN3CCN(c4cnccn4)CC3)n2)cc1 |
| InChI | InChI=1S/C16H17FN8/c17-14-3-1-13(2-4-14)16-20-22-25(21-16)12-23-7-9-24(10-8-23)15-11-18-5-6-19-15/h1-6,11H,7-10,12H2 |
| InChIKey | CVHSZJMJNHMMNA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |