C19H20FN7S — CID 18150117
5-[(E)-2-(4-fluorophenyl)ethenyl]-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 18150117) has the molecular formula C19H20FN7S and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-[(E)-2-(4-fluorophenyl)ethenyl]-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18150117 |
| Molecular Formula | C19H20FN7S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 5-[(E)-2-(4-fluorophenyl)ethenyl]-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc(/C=C/c2nc(=S)n(CN3CCN(c4cnccn4)CC3)[nH]2)cc1 |
| InChI | InChI=1S/C19H20FN7S/c20-16-4-1-15(2-5-16)3-6-17-23-19(28)27(24-17)14-25-9-11-26(12-10-25)18-13-21-7-8-22-18/h1-8,13H,9-12,14H2,(H,23,24,28)/b6-3+ |
| InChIKey | KYUYZXCFHISDGA-ZZXKWVIFSA-N |
| XLogP | 2.82 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|