C14H18N4OS — CID 3115115
4-methyl-2-(morpholin-4-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 3115115) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-methyl-2-(morpholin-4-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 4-methyl-2-(morpholin-4-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 3115115 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-methyl-2-(morpholin-4-ylmethyl)-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2)nn(CN2CCOCC2)c1=S |
| InChI | InChI=1S/C14H18N4OS/c1-16-13(12-5-3-2-4-6-12)15-18(14(16)20)11-17-7-9-19-10-8-17/h2-6H,7-11H2,1H3 |
| InChIKey | KVAGAWVKLLEXGY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|