C17H18F3N2+ — CID 6939728
1-[(2,4-difluorophenyl)methyl]-4-(2-fluorophenyl)piperazin-1-ium (PubChem CID 6939728) has the molecular formula C17H18F3N2+ and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-(2-fluorophenyl)piperazin-1-ium.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-(2-fluorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6939728 |
| Molecular Formula | C17H18F3N2+ |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-(2-fluorophenyl)piperazin-1-ium |
| SMILES | Fc1ccc(C[NH+]2CCN(c3ccccc3F)CC2)c(F)c1 |
| InChI | InChI=1S/C17H17F3N2/c18-14-6-5-13(16(20)11-14)12-21-7-9-22(10-8-21)17-4-2-1-3-15(17)19/h1-6,11H,7-10,12H2/p+1 |
| InChIKey | FQWNVXTUUGCCAN-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |