C18H21F2N2+ — CID 6942770
1-[(2,4-difluorophenyl)methyl]-4-(4-methylphenyl)piperazin-1-ium (PubChem CID 6942770) has the molecular formula C18H21F2N2+ and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-(4-methylphenyl)piperazin-1-ium.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-4-(4-methylphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6942770 |
| Molecular Formula | C18H21F2N2+ |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-4-(4-methylphenyl)piperazin-1-ium |
| SMILES | Cc1ccc(N2CC[NH+](Cc3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C18H20F2N2/c1-14-2-6-17(7-3-14)22-10-8-21(9-11-22)13-15-4-5-16(19)12-18(15)20/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | CDOJPKCCMUORJC-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|