C17H19F2N2+ — CID 6942759
1-[(2,5-difluorophenyl)methyl]-4-phenylpiperazin-1-ium (PubChem CID 6942759) has the molecular formula C17H19F2N2+ and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 6942759 |
| Molecular Formula | C17H19F2N2+ |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-4-phenylpiperazin-1-ium |
| SMILES | Fc1ccc(F)c(C[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C17H18F2N2/c18-15-6-7-17(19)14(12-15)13-20-8-10-21(11-9-20)16-4-2-1-3-5-16/h1-7,12H,8-11,13H2/p+1 |
| InChIKey | VTLHGZGUEUQCEP-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |