C22H30FN3+2 — CID 7403675
1-[1-[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]-4-phenylpiperazin-1-ium (PubChem CID 7403675) has the molecular formula C22H30FN3+2 and a molecular weight of 355.50 g/mol. Its IUPAC name is 1-[1-[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[1-[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7403675 |
| Molecular Formula | C22H30FN3+2 |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 1-[1-[(3-fluorophenyl)methyl]piperidin-1-ium-4-yl]-4-phenylpiperazin-1-ium |
| SMILES | Fc1cccc(C[NH+]2CCC([NH+]3CCN(c4ccccc4)CC3)CC2)c1 |
| InChI | InChI=1S/C22H28FN3/c23-20-6-4-5-19(17-20)18-24-11-9-22(10-12-24)26-15-13-25(14-16-26)21-7-2-1-3-8-21/h1-8,17,22H,9-16,18H2/p+2 |
| InChIKey | LBKHDUOMTXIYGA-UHFFFAOYSA-P |
| XLogP | 0.78 |
| TPSA | 12.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |