C17H20FN2O+ — CID 8528521
2-[4-[(3-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenol (PubChem CID 8528521) has the molecular formula C17H20FN2O+ and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenol.
| Compound Name | 2-[4-[(3-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenol |
|---|---|
| PubChem CID | 8528521 |
| Molecular Formula | C17H20FN2O+ |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[4-[(3-fluorophenyl)methyl]piperazin-4-ium-1-yl]phenol |
| SMILES | Oc1ccccc1N1CC[NH+](Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H19FN2O/c18-15-5-3-4-14(12-15)13-19-8-10-20(11-9-19)16-6-1-2-7-17(16)21/h1-7,12,21H,8-11,13H2/p+1 |
| InChIKey | RMEYSINQQKYKAB-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |