C20H21Cl2N4+ — CID 7317326
1-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-4-phenylpiperazin-1-ium (PubChem CID 7317326) has the molecular formula C20H21Cl2N4+ and a molecular weight of 388.32 g/mol. Its IUPAC name is 1-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7317326 |
| Molecular Formula | C20H21Cl2N4+ |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1-[[5-(2,4-dichlorophenyl)-1H-pyrazol-4-yl]methyl]-4-phenylpiperazin-1-ium |
| SMILES | Clc1ccc(-c2[nH]ncc2C[NH+]2CCN(c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4/c21-16-6-7-18(19(22)12-16)20-15(13-23-24-20)14-25-8-10-26(11-9-25)17-4-2-1-3-5-17/h1-7,12-13H,8-11,14H2,(H,23,24)/p+1 |
| InChIKey | HYMCBYTYYMVFTC-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |