C19H20ClN4O+ — CID 6987170
4-[[4-(4-chlorophenyl)piperazin-1-ium-1-yl]methyl]-2H-phthalazin-1-one (PubChem CID 6987170) has the molecular formula C19H20ClN4O+ and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)piperazin-1-ium-1-yl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-(4-chlorophenyl)piperazin-1-ium-1-yl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 6987170 |
| Molecular Formula | C19H20ClN4O+ |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)piperazin-1-ium-1-yl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(C[NH+]2CCN(c3ccc(Cl)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C19H19ClN4O/c20-14-5-7-15(8-6-14)24-11-9-23(10-12-24)13-18-16-3-1-2-4-17(16)19(25)22-21-18/h1-8H,9-13H2,(H,22,25)/p+1 |
| InChIKey | QFULQDFAECXGOG-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |