C22H25ClN3+ — CID 9344953
2-chloro-7,8-dimethyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]quinoline (PubChem CID 9344953) has the molecular formula C22H25ClN3+ and a molecular weight of 366.92 g/mol. Its IUPAC name is 2-chloro-7,8-dimethyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]quinoline.
| Compound Name | 2-chloro-7,8-dimethyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 9344953 |
| Molecular Formula | C22H25ClN3+ |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-chloro-7,8-dimethyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]quinoline |
| SMILES | Cc1ccc2cc(C[NH+]3CCN(c4ccccc4)CC3)c(Cl)nc2c1C |
| InChI | InChI=1S/C22H24ClN3/c1-16-8-9-18-14-19(22(23)24-21(18)17(16)2)15-25-10-12-26(13-11-25)20-6-4-3-5-7-20/h3-9,14H,10-13,15H2,1-2H3/p+1 |
| InChIKey | KZUSIIDMFFNEBZ-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 20.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|