C20H26ClN2O2+ — CID 8718903
ethyl 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 8718903) has the molecular formula C20H26ClN2O2+ and a molecular weight of 361.89 g/mol. Its IUPAC name is ethyl 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8718903 |
| Molecular Formula | C20H26ClN2O2+ |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2cc3ccc(C)c(C)c3nc2Cl)CC1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-4-25-20(24)15-7-9-23(10-8-15)12-17-11-16-6-5-13(2)14(3)18(16)22-19(17)21/h5-6,11,15H,4,7-10,12H2,1-3H3/p+1 |
| InChIKey | IDJJGNGPNLEACU-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|