C18H22NO4+ — CID 7378003
ethyl 1-[(4-oxochromen-3-yl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 7378003) has the molecular formula C18H22NO4+ and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 1-[(4-oxochromen-3-yl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(4-oxochromen-3-yl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7378003 |
| Molecular Formula | C18H22NO4+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl 1-[(4-oxochromen-3-yl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2coc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C18H21NO4/c1-2-22-18(21)13-7-9-19(10-8-13)11-14-12-23-16-6-4-3-5-15(16)17(14)20/h3-6,12-13H,2,7-11H2,1H3/p+1 |
| InChIKey | DMMARHMXGLUROF-UHFFFAOYSA-O |
| XLogP | 1.15 |
| TPSA | 60.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |