C21H24N2O2+2 — CID 7367107
3-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one (PubChem CID 7367107) has the molecular formula C21H24N2O2+2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one.
| Compound Name | 3-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 7367107 |
| Molecular Formula | C21H24N2O2+2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one |
| SMILES | O=c1c(C[NH+]2CC[NH+](Cc3ccccc3)CC2)coc2ccccc12 |
| InChI | InChI=1S/C21H22N2O2/c24-21-18(16-25-20-9-5-4-8-19(20)21)15-23-12-10-22(11-13-23)14-17-6-2-1-3-7-17/h1-9,16H,10-15H2/p+2 |
| InChIKey | NXKAXFXPOZEBIR-UHFFFAOYSA-P |
| XLogP | 0.28 |
| TPSA | 39.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |