C23H28N2O2+2 — CID 2002584
4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5,7-dimethylchromen-2-one (PubChem CID 2002584) has the molecular formula C23H28N2O2+2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5,7-dimethylchromen-2-one.
| Compound Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2002584 |
| Molecular Formula | C23H28N2O2+2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-5,7-dimethylchromen-2-one |
| SMILES | Cc1cc(C)c2c(C[NH+]3CC[NH+](Cc4ccccc4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-17-12-18(2)23-20(14-22(26)27-21(23)13-17)16-25-10-8-24(9-11-25)15-19-6-4-3-5-7-19/h3-7,12-14H,8-11,15-16H2,1-2H3/p+2 |
| InChIKey | XDAGLZQVAFKDDB-UHFFFAOYSA-P |
| XLogP | 0.89 |
| TPSA | 39.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|