C19H18NO2+ — CID 7047564
3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)chromen-4-one (PubChem CID 7047564) has the molecular formula C19H18NO2+ and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)chromen-4-one.
| Compound Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 7047564 |
| Molecular Formula | C19H18NO2+ |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)chromen-4-one |
| SMILES | O=c1c(C[NH+]2CCc3ccccc3C2)coc2ccccc12 |
| InChI | InChI=1S/C19H17NO2/c21-19-16(13-22-18-8-4-3-7-17(18)19)12-20-10-9-14-5-1-2-6-15(14)11-20/h1-8,13H,9-12H2/p+1 |
| InChIKey | LTTRMYOQBAGCAY-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |