C16H15I2NO — CID 27267159
2,4-diiodo-6-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)phenolate (PubChem CID 27267159) has the molecular formula C16H15I2NO and a molecular weight of 491.11 g/mol. Its IUPAC name is 2,4-diiodo-6-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)phenolate.
| Compound Name | 2,4-diiodo-6-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)phenolate |
|---|---|
| PubChem CID | 27267159 |
| Molecular Formula | C16H15I2NO |
| Molecular Weight | 491.11 g/mol |
| Exact Mass | 490.92 |
| IUPAC Name | 2,4-diiodo-6-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)phenolate |
| SMILES | [O-]c1c(I)cc(I)cc1C[NH+]1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H15I2NO/c17-14-7-13(16(20)15(18)8-14)10-19-6-5-11-3-1-2-4-12(11)9-19/h1-4,7-8,20H,5-6,9-10H2 |
| InChIKey | UAAXHBRCMFIALM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|