C18H23N2+ — CID 6939785
N,N-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)aniline (PubChem CID 6939785) has the molecular formula C18H23N2+ and a molecular weight of 267.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)aniline.
| Compound Name | N,N-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 6939785 |
| Molecular Formula | C18H23N2+ |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N,N-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)aniline |
| SMILES | CN(C)c1ccc(C[NH+]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-19(2)18-9-7-15(8-10-18)13-20-12-11-16-5-3-4-6-17(16)14-20/h3-10H,11-14H2,1-2H3/p+1 |
| InChIKey | XJUDTSWWFPVDNI-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|