C24H31N2O+ — CID 6980201
N-cycloheptyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide (PubChem CID 6980201) has the molecular formula C24H31N2O+ and a molecular weight of 363.52 g/mol. Its IUPAC name is N-cycloheptyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide.
| Compound Name | N-cycloheptyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 6980201 |
| Molecular Formula | C24H31N2O+ |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-cycloheptyl-4-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(C[NH+]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H30N2O/c27-24(25-23-9-3-1-2-4-10-23)21-13-11-19(12-14-21)17-26-16-15-20-7-5-6-8-22(20)18-26/h5-8,11-14,23H,1-4,9-10,15-18H2,(H,25,27)/p+1 |
| InChIKey | JENGUUDAHAOGLC-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |