C15H24N3O+ — CID 6966405
1-[[4-(dimethylamino)phenyl]methyl]piperidin-1-ium-4-carboxamide (PubChem CID 6966405) has the molecular formula C15H24N3O+ and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6966405 |
| Molecular Formula | C15H24N3O+ |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]piperidin-1-ium-4-carboxamide |
| SMILES | CN(C)c1ccc(C[NH+]2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C15H23N3O/c1-17(2)14-5-3-12(4-6-14)11-18-9-7-13(8-10-18)15(16)19/h3-6,13H,7-11H2,1-2H3,(H2,16,19)/p+1 |
| InChIKey | YUVFUAFRFGRJTA-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|