C15H22N3O2+ — CID 8556648
1-[2-(N-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8556648) has the molecular formula C15H22N3O2+ and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-[2-(N-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(N-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8556648 |
| Molecular Formula | C15H22N3O2+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[2-(N-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CN(C(=O)C[NH+]1CCC(C(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O2/c1-17(13-5-3-2-4-6-13)14(19)11-18-9-7-12(8-10-18)15(16)20/h2-6,12H,7-11H2,1H3,(H2,16,20)/p+1 |
| InChIKey | QYPUGCQIJWSXMD-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |