C20H26N2 — CID 134795524
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 134795524) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 134795524 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CN(C)c1ccc(CN(C)C2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H26N2/c1-21(2)19-11-8-16(9-12-19)15-22(3)20-13-10-17-6-4-5-7-18(17)14-20/h4-9,11-12,20H,10,13-15H2,1-3H3 |
| InChIKey | GHWUDLIVSBQYAB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|