C18H21NO — CID 143888403
N,N-dimethyl-2-oxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-10-amine (PubChem CID 143888403) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N,N-dimethyl-2-oxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-10-amine.
| Compound Name | N,N-dimethyl-2-oxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-10-amine |
|---|---|
| PubChem CID | 143888403 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N,N-dimethyl-2-oxatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-10-amine |
| SMILES | CN(C)C1CCc2ccccc2Oc2ccccc2C1 |
| InChI | InChI=1S/C18H21NO/c1-19(2)16-12-11-14-7-3-5-9-17(14)20-18-10-6-4-8-15(18)13-16/h3-10,16H,11-13H2,1-2H3 |
| InChIKey | DHKGDRUSDZSZHI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |