C22H24ClN4O+ — CID 9172516
4-chloro-5-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]-2-phenylpyridazin-3-one (PubChem CID 9172516) has the molecular formula C22H24ClN4O+ and a molecular weight of 395.91 g/mol. Its IUPAC name is 4-chloro-5-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 9172516 |
| Molecular Formula | C22H24ClN4O+ |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-chloro-5-[4-[(2-methylphenyl)methyl]piperazin-4-ium-1-yl]-2-phenylpyridazin-3-one |
| SMILES | Cc1ccccc1C[NH+]1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C22H23ClN4O/c1-17-7-5-6-8-18(17)16-25-11-13-26(14-12-25)20-15-24-27(22(28)21(20)23)19-9-3-2-4-10-19/h2-10,15H,11-14,16H2,1H3/p+1 |
| InChIKey | SNZUOGCIDBPDPB-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |