C17H17ClF4N4O — CID 133314120
4-chloro-2-phenyl-5-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 133314120) has the molecular formula C17H17ClF4N4O and a molecular weight of 404.80 g/mol. Its IUPAC name is 4-chloro-2-phenyl-5-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-phenyl-5-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133314120 |
| Molecular Formula | C17H17ClF4N4O |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-chloro-2-phenyl-5-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(CC(F)(F)C(F)F)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C17H17ClF4N4O/c18-14-13(10-23-26(15(14)27)12-4-2-1-3-5-12)25-8-6-24(7-9-25)11-17(21,22)16(19)20/h1-5,10,16H,6-9,11H2 |
| InChIKey | QHQJNEFSDGHLGH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|