C20H18ClFN4O3S — CID 26451386
4-chloro-5-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 26451386) has the molecular formula C20H18ClFN4O3S and a molecular weight of 448.91 g/mol. Its IUPAC name is 4-chloro-5-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 26451386 |
| Molecular Formula | C20H18ClFN4O3S |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-chloro-5-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(S(=O)(=O)c3ccccc3F)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C20H18ClFN4O3S/c21-19-17(14-23-26(20(19)27)15-6-2-1-3-7-15)24-10-12-25(13-11-24)30(28,29)18-9-5-4-8-16(18)22/h1-9,14H,10-13H2 |
| InChIKey | XGMOWDYBNRZEGN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |