C20H27ClN5O2+ — CID 9338030
N-tert-butyl-2-[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9338030) has the molecular formula C20H27ClN5O2+ and a molecular weight of 404.92 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9338030 |
| Molecular Formula | C20H27ClN5O2+ |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-tert-butyl-2-[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)C[NH+]1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-20(2,3)23-17(27)14-24-9-11-25(12-10-24)16-13-22-26(19(28)18(16)21)15-7-5-4-6-8-15/h4-8,13H,9-12,14H2,1-3H3,(H,23,27)/p+1 |
| InChIKey | OTCVUZFDPFXHJK-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |