C20H28ClN3O2S+2 — CID 9055732
(3S)-3-[4-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperazine-1,4-diium-1-yl]thiolane 1,1-dioxide (PubChem CID 9055732) has the molecular formula C20H28ClN3O2S+2 and a molecular weight of 409.98 g/mol. Its IUPAC name is (3S)-3-[4-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperazine-1,4-diium-1-yl]thiolane 1,1-dioxide.
| Compound Name | (3S)-3-[4-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperazine-1,4-diium-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 9055732 |
| Molecular Formula | C20H28ClN3O2S+2 |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (3S)-3-[4-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]piperazine-1,4-diium-1-yl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc2cc(C[NH+]3CC[NH+]([C@H]4CCS(=O)(=O)C4)CC3)c(Cl)nc2c1C |
| InChI | InChI=1S/C20H26ClN3O2S/c1-14-3-4-16-11-17(20(21)22-19(16)15(14)2)12-23-6-8-24(9-7-23)18-5-10-27(25,26)13-18/h3-4,11,18H,5-10,12-13H2,1-2H3/p+2/t18-/m0/s1 |
| InChIKey | LNYFSTVRXQGKSX-SFHVURJKSA-P |
| XLogP | -0.02 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|