C20H19ClF2N2 — CID 8710678
(1R)-N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-(3,4-difluorophenyl)ethanamine (PubChem CID 8710678) has the molecular formula C20H19ClF2N2 and a molecular weight of 360.84 g/mol. Its IUPAC name is (1R)-N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-(3,4-difluorophenyl)ethanamine.
| Compound Name | (1R)-N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-(3,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 8710678 |
| Molecular Formula | C20H19ClF2N2 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (1R)-N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-(3,4-difluorophenyl)ethanamine |
| SMILES | Cc1ccc2cc(CN[C@H](C)c3ccc(F)c(F)c3)c(Cl)nc2c1C |
| InChI | InChI=1S/C20H19ClF2N2/c1-11-4-5-15-8-16(20(21)25-19(15)12(11)2)10-24-13(3)14-6-7-17(22)18(23)9-14/h4-9,13,24H,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | VVQOEAMZIQHXHL-CYBMUJFWSA-N |
| XLogP | 5.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|