C24H30ClN3O2+2 — CID 8719856
2-chloro-3-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]quinoline (PubChem CID 8719856) has the molecular formula C24H30ClN3O2+2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 2-chloro-3-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]quinoline.
| Compound Name | 2-chloro-3-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 8719856 |
| Molecular Formula | C24H30ClN3O2+2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-chloro-3-[[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]quinoline |
| SMILES | COc1cc(C)c(C[NH+]2CC[NH+](Cc3cc4ccccc4nc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C24H28ClN3O2/c1-17-12-22(29-2)23(30-3)14-19(17)15-27-8-10-28(11-9-27)16-20-13-18-6-4-5-7-21(18)26-24(20)25/h4-7,12-14H,8-11,15-16H2,1-3H3/p+2 |
| InChIKey | LUCCHSJIVJZKFR-UHFFFAOYSA-P |
| XLogP | 1.70 |
| TPSA | 40.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|